C7H12N4O — CID 165472803
2-(cyclopropylmethoxymethyl)triazol-4-amine (PubChem CID 165472803) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-(cyclopropylmethoxymethyl)triazol-4-amine.
| Compound Name | 2-(cyclopropylmethoxymethyl)triazol-4-amine |
|---|---|
| PubChem CID | 165472803 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-(cyclopropylmethoxymethyl)triazol-4-amine |
| SMILES | Nc1cnn(COCC2CC2)n1 |
| InChI | InChI=1S/C7H12N4O/c8-7-3-9-11(10-7)5-12-4-6-1-2-6/h3,6H,1-2,4-5H2,(H2,8,10) |
| InChIKey | QSAQFXDDPFEISR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |