About 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine
2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine (PubChem CID 67958100) has the molecular formula C8H11N5OS
and a molecular weight of 225.28 g/mol. Its IUPAC name is 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine.
Molecular Properties
| Compound Name | 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine |
| PubChem CID | 67958100 |
| Molecular Formula | C8H11N5OS |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine |
| SMILES | COCc1ncc(Cn2ncc(N)n2)s1 |
| InChI | InChI=1S/C8H11N5OS/c1-14-5-8-10-2-6(15-8)4-13-11-3-7(9)12-13/h2-3H,4-5H2,1H3,(H2,9,12) |
| InChIKey | NAQZHHZUTOKFLF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine?
The IUPAC name of 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine (CID 67958100) is 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine.
What is the SMILES notation for 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine?
The canonical SMILES for 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine is COCc1ncc(Cn2ncc(N)n2)s1.
What is the InChIKey of 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine?
The InChIKey is NAQZHHZUTOKFLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5OS/c1-14-5-8-10-2-6(15-8)4-13-11-3-7(9)12-13/h2-3H,4-5H2,1H3,(H2,9,12).
What are the key properties of 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine?
2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine has a molecular weight of 225.28 g/mol, XLogP of 0.51, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(methoxymethyl)-1,3-thiazol-5-yl]methyl]triazol-4-amine is sourced from PubChem (CID 67958100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).