C7H10F2N4 — CID 165479364
2-[(3,3-difluorocyclobutyl)methyl]triazol-4-amine (PubChem CID 165479364) has the molecular formula C7H10F2N4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclobutyl)methyl]triazol-4-amine.
| Compound Name | 2-[(3,3-difluorocyclobutyl)methyl]triazol-4-amine |
|---|---|
| PubChem CID | 165479364 |
| Molecular Formula | C7H10F2N4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-[(3,3-difluorocyclobutyl)methyl]triazol-4-amine |
| SMILES | Nc1cnn(CC2CC(F)(F)C2)n1 |
| InChI | InChI=1S/C7H10F2N4/c8-7(9)1-5(2-7)4-13-11-3-6(10)12-13/h3,5H,1-2,4H2,(H2,10,12) |
| InChIKey | YNZVVIORCULKDW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |