C4H6F2N4 — CID 146075351
2-(2,2-difluoroethyl)triazol-4-amine (PubChem CID 146075351) has the molecular formula C4H6F2N4 and a molecular weight of 148.12 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)triazol-4-amine.
| Compound Name | 2-(2,2-difluoroethyl)triazol-4-amine |
|---|---|
| PubChem CID | 146075351 |
| Molecular Formula | C4H6F2N4 |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2-(2,2-difluoroethyl)triazol-4-amine |
| SMILES | Nc1cnn(CC(F)F)n1 |
| InChI | InChI=1S/C4H6F2N4/c5-3(6)2-10-8-1-4(7)9-10/h1,3H,2H2,(H2,7,9) |
| InChIKey | KIHHSUJCKWBSKH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |