C9H8F2N4 — CID 165479947
2-[(2,3-difluorophenyl)methyl]triazol-4-amine (PubChem CID 165479947) has the molecular formula C9H8F2N4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methyl]triazol-4-amine.
| Compound Name | 2-[(2,3-difluorophenyl)methyl]triazol-4-amine |
|---|---|
| PubChem CID | 165479947 |
| Molecular Formula | C9H8F2N4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methyl]triazol-4-amine |
| SMILES | Nc1cnn(Cc2cccc(F)c2F)n1 |
| InChI | InChI=1S/C9H8F2N4/c10-7-3-1-2-6(9(7)11)5-15-13-4-8(12)14-15/h1-4H,5H2,(H2,12,14) |
| InChIKey | JAAUXNDMLCQVCH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |