About ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate
ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate (PubChem CID 122240406) has the molecular formula C11H14F2N2O2
and a molecular weight of 244.24 g/mol. Its IUPAC name is ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate.
Analyze ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate?
The IUPAC name of ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate (CID 122240406) is ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate?
The canonical SMILES for ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate is CCOC(=O)c1cnn(CC2CC(F)(F)C2)c1.
What is the InChIKey of ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate?
The InChIKey is QGZJLRBKVWGOIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2N2O2/c1-2-17-10(16)9-5-14-15(7-9)6-8-3-11(12,13)4-8/h5,7-8H,2-4,6H2,1H3.
What are the key properties of ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate?
ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate has a molecular weight of 244.24 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(3,3-difluorocyclobutyl)methyl]pyrazole-4-carboxylate is sourced from PubChem (CID 122240406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).