C13H11F3N2O2 — CID 170757143
ethyl 1-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylate (PubChem CID 170757143) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is ethyl 1-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 170757143 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | ethyl 1-[(3,4,5-trifluorophenyl)methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(Cc2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C13H11F3N2O2/c1-2-20-13(19)9-5-17-18(7-9)6-8-3-10(14)12(16)11(15)4-8/h3-5,7H,2,6H2,1H3 |
| InChIKey | FJTCNDAIEXWQES-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|