C14H15IN2O3 — CID 166964963
ethyl 1-[[4-(iodomethoxy)phenyl]methyl]pyrazole-4-carboxylate (PubChem CID 166964963) has the molecular formula C14H15IN2O3 and a molecular weight of 386.19 g/mol. Its IUPAC name is ethyl 1-[[4-(iodomethoxy)phenyl]methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[[4-(iodomethoxy)phenyl]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 166964963 |
| Molecular Formula | C14H15IN2O3 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | ethyl 1-[[4-(iodomethoxy)phenyl]methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(Cc2ccc(OCI)cc2)c1 |
| InChI | InChI=1S/C14H15IN2O3/c1-2-19-14(18)12-7-16-17(9-12)8-11-3-5-13(6-4-11)20-10-15/h3-7,9H,2,8,10H2,1H3 |
| InChIKey | WWEHLIUEVCOJBB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|