C17H17F3N2O3 — CID 166738242
ethyl 1-[[4-[(E)-4,4,4-trifluorobut-2-en-2-yl]oxyphenyl]methyl]pyrazole-4-carboxylate (PubChem CID 166738242) has the molecular formula C17H17F3N2O3 and a molecular weight of 354.33 g/mol. Its IUPAC name is ethyl 1-[[4-[(E)-4,4,4-trifluorobut-2-en-2-yl]oxyphenyl]methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[[4-[(E)-4,4,4-trifluorobut-2-en-2-yl]oxyphenyl]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 166738242 |
| Molecular Formula | C17H17F3N2O3 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | ethyl 1-[[4-[(E)-4,4,4-trifluorobut-2-en-2-yl]oxyphenyl]methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(Cc2ccc(O/C(C)=C/C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H17F3N2O3/c1-3-24-16(23)14-9-21-22(11-14)10-13-4-6-15(7-5-13)25-12(2)8-17(18,19)20/h4-9,11H,3,10H2,1-2H3/b12-8+ |
| InChIKey | NCPIOCQLNBQDKD-XYOKQWHBSA-N |
| XLogP | 3.95 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|