C16H17BrN2O4 — CID 54231623
1-[[3-(2-bromoethyl)-5-ethoxycarbonylphenyl]methyl]pyrazole-4-carboxylic acid (PubChem CID 54231623) has the molecular formula C16H17BrN2O4 and a molecular weight of 381.23 g/mol. Its IUPAC name is 1-[[3-(2-bromoethyl)-5-ethoxycarbonylphenyl]methyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[[3-(2-bromoethyl)-5-ethoxycarbonylphenyl]methyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 54231623 |
| Molecular Formula | C16H17BrN2O4 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 1-[[3-(2-bromoethyl)-5-ethoxycarbonylphenyl]methyl]pyrazole-4-carboxylic acid |
| SMILES | CCOC(=O)c1cc(CCBr)cc(Cn2cc(C(=O)O)cn2)c1 |
| InChI | InChI=1S/C16H17BrN2O4/c1-2-23-16(22)13-6-11(3-4-17)5-12(7-13)9-19-10-14(8-18-19)15(20)21/h5-8,10H,2-4,9H2,1H3,(H,20,21) |
| InChIKey | QJRIBQJKQGCLIK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|