methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate

C10H12F2N2O2 — CID 170957684

IUPACmethyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate
SMILESCOC(=O)c1cn(CC2CC(F)(F)C2)cn1
InChIInChI=1S/C10H12F2N2O2/c1-16-9(15)8-5-14(6-13-8)4-7-2-10(11,12)3-7/h5-7H,2-4H2,1H3
InChIKeyNISNUAGUUKTFTB-UHFFFAOYSA-N
MW230.21 g/mol
LogP1.72
Rot. Bonds3

About methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate

methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate (PubChem CID 170957684) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate.

Molecular Properties

Compound Namemethyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate
PubChem CID170957684
Molecular FormulaC10H12F2N2O2
Molecular Weight230.21 g/mol
Exact Mass230.09
IUPAC Namemethyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate
SMILESCOC(=O)c1cn(CC2CC(F)(F)C2)cn1
InChIInChI=1S/C10H12F2N2O2/c1-16-9(15)8-5-14(6-13-8)4-7-2-10(11,12)3-7/h5-7H,2-4H2,1H3
InChIKeyNISNUAGUUKTFTB-UHFFFAOYSA-N
XLogP1.72
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.21
LogP ≤ 51.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate?
The IUPAC name of methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate (CID 170957684) is methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate.
What is the SMILES notation for methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate?
The canonical SMILES for methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate is COC(=O)c1cn(CC2CC(F)(F)C2)cn1.
What is the InChIKey of methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate?
The InChIKey is NISNUAGUUKTFTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2O2/c1-16-9(15)8-5-14(6-13-8)4-7-2-10(11,12)3-7/h5-7H,2-4H2,1H3.
What are the key properties of methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate?
methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate has a molecular weight of 230.21 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(3,3-difluorocyclobutyl)methyl]imidazole-4-carboxylate is sourced from PubChem (CID 170957684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).