C12H10N6 — CID 113384297
3-(1-pyrimidin-4-yl-1,2,4-triazol-3-yl)aniline (PubChem CID 113384297) has the molecular formula C12H10N6 and a molecular weight of 238.25 g/mol. Its IUPAC name is 3-(1-pyrimidin-4-yl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 3-(1-pyrimidin-4-yl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 113384297 |
| Molecular Formula | C12H10N6 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-(1-pyrimidin-4-yl-1,2,4-triazol-3-yl)aniline |
| SMILES | Nc1cccc(-c2ncn(-c3ccncn3)n2)c1 |
| InChI | InChI=1S/C12H10N6/c13-10-3-1-2-9(6-10)12-16-8-18(17-12)11-4-5-14-7-15-11/h1-8H,13H2 |
| InChIKey | AGAGHXFHNOHBJJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|