C14H11BrFN3O2 — CID 133422402
2-(5-bromo-3-nitro-2-pyridinyl)-6-fluoro-3,4-dihydro-1H-isoquinoline (PubChem CID 133422402) has the molecular formula C14H11BrFN3O2 and a molecular weight of 352.16 g/mol. Its IUPAC name is 2-(5-bromo-3-nitro-2-pyridinyl)-6-fluoro-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(5-bromo-3-nitro-2-pyridinyl)-6-fluoro-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 133422402 |
| Molecular Formula | C14H11BrFN3O2 |
| Molecular Weight | 352.16 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2-(5-bromo-3-nitro-2-pyridinyl)-6-fluoro-3,4-dihydro-1H-isoquinoline |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1N1CCc2cc(F)ccc2C1 |
| InChI | InChI=1S/C14H11BrFN3O2/c15-11-6-13(19(20)21)14(17-7-11)18-4-3-9-5-12(16)2-1-10(9)8-18/h1-2,5-7H,3-4,8H2 |
| InChIKey | IXCPRVVNEFFAAS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.16 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|