C14H22IN7 — CID 158176837
iodomethane;2-(4-methylpiperidin-1-yl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)pyrimidin-4-amine (PubChem CID 158176837) has the molecular formula C14H22IN7 and a molecular weight of 415.28 g/mol. Its IUPAC name is iodomethane;2-(4-methylpiperidin-1-yl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)pyrimidin-4-amine.
| Compound Name | iodomethane;2-(4-methylpiperidin-1-yl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 158176837 |
| Molecular Formula | C14H22IN7 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | iodomethane;2-(4-methylpiperidin-1-yl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)pyrimidin-4-amine |
| SMILES | CI.Cc1nc(Nc2ccnc(N3CCC(C)CC3)n2)n[nH]1 |
| InChI | InChI=1S/C13H19N7.CH3I/c1-9-4-7-20(8-5-9)13-14-6-3-11(17-13)16-12-15-10(2)18-19-12;1-2/h3,6,9H,4-5,7-8H2,1-2H3,(H2,14,15,16,17,18,19);1H3 |
| InChIKey | FYCIVMRAUNGWPE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|