C4H7BN8O7 — CID 175072074
boric acid;bis(5-nitro-1H-1,2,4-triazole) (PubChem CID 175072074) has the molecular formula C4H7BN8O7 and a molecular weight of 289.96 g/mol. Its IUPAC name is boric acid;bis(5-nitro-1H-1,2,4-triazole).
| Compound Name | boric acid;bis(5-nitro-1H-1,2,4-triazole) |
|---|---|
| PubChem CID | 175072074 |
| Molecular Formula | C4H7BN8O7 |
| Molecular Weight | 289.96 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | boric acid;bis(5-nitro-1H-1,2,4-triazole) |
| SMILES | O=[N+]([O-])c1ncn[nH]1.O=[N+]([O-])c1ncn[nH]1.OB(O)O |
| InChI | InChI=1S/2C2H2N4O2.BH3O3/c2*7-6(8)2-3-1-4-5-2;2-1(3)4/h2*1H,(H,3,4,5);2-4H |
| InChIKey | GYADCHUFIXSAMW-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 230.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.96 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|