C9H7N5O3 — CID 135615334
2-nitro-6-[(E)-1H-1,2,4-triazol-5-yliminomethyl]phenol (PubChem CID 135615334) has the molecular formula C9H7N5O3 and a molecular weight of 233.19 g/mol. Its IUPAC name is 2-nitro-6-[(E)-1H-1,2,4-triazol-5-yliminomethyl]phenol.
| Compound Name | 2-nitro-6-[(E)-1H-1,2,4-triazol-5-yliminomethyl]phenol |
|---|---|
| PubChem CID | 135615334 |
| Molecular Formula | C9H7N5O3 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-nitro-6-[(E)-1H-1,2,4-triazol-5-yliminomethyl]phenol |
| SMILES | O=[N+]([O-])c1cccc(/C=N/c2ncn[nH]2)c1O |
| InChI | InChI=1S/C9H7N5O3/c15-8-6(2-1-3-7(8)14(16)17)4-10-9-11-5-12-13-9/h1-5,15H,(H,11,12,13)/b10-4+ |
| InChIKey | KHRPXHHAQYRBEP-ONNFQVAWSA-N |
| XLogP | 1.17 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|