C4HN3Na2O4 — CID 171114647
disodium;5-nitropyrimidine-4,6-diolate (PubChem CID 171114647) has the molecular formula C4HN3Na2O4 and a molecular weight of 201.05 g/mol. Its IUPAC name is disodium;5-nitropyrimidine-4,6-diolate.
| Compound Name | disodium;5-nitropyrimidine-4,6-diolate |
|---|---|
| PubChem CID | 171114647 |
| Molecular Formula | C4HN3Na2O4 |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 200.98 |
| IUPAC Name | disodium;5-nitropyrimidine-4,6-diolate |
| SMILES | O=[N+]([O-])c1c([O-])ncnc1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H3N3O4.2Na/c8-3-2(7(10)11)4(9)6-1-5-3;;/h1H,(H2,5,6,8,9);;/q;2*+1/p-2 |
| InChIKey | GAWVKBXZCICZOX-UHFFFAOYSA-L |
| XLogP | -7.46 |
| TPSA | 115.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | -7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|