About 2,3,4,5-tetranitropyridine
2,3,4,5-tetranitropyridine (PubChem CID 135563868) has the molecular formula C5HN5O8
and a molecular weight of 259.09 g/mol. Its IUPAC name is 2,3,4,5-tetranitropyridine.
Molecular Properties
| Compound Name | 2,3,4,5-tetranitropyridine |
| PubChem CID | 135563868 |
| Molecular Formula | C5HN5O8 |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 2,3,4,5-tetranitropyridine |
| SMILES | O=[N+]([O-])c1cnc([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C5HN5O8/c11-7(12)2-1-6-5(10(17)18)4(9(15)16)3(2)8(13)14/h1H |
| InChIKey | UHTDATQVIGYQMZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 185.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4,5-tetranitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetranitropyridine?
The IUPAC name of 2,3,4,5-tetranitropyridine (CID 135563868) is 2,3,4,5-tetranitropyridine.
What is the SMILES notation for 2,3,4,5-tetranitropyridine?
The canonical SMILES for 2,3,4,5-tetranitropyridine is O=[N+]([O-])c1cnc([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of 2,3,4,5-tetranitropyridine?
The InChIKey is UHTDATQVIGYQMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HN5O8/c11-7(12)2-1-6-5(10(17)18)4(9(15)16)3(2)8(13)14/h1H.
What are the key properties of 2,3,4,5-tetranitropyridine?
2,3,4,5-tetranitropyridine has a molecular weight of 259.09 g/mol, XLogP of 0.71, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetranitropyridine is sourced from PubChem (CID 135563868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).