C6HIN4O8 — CID 13333982
2-iodo-1,3,4,5-tetranitrobenzene (PubChem CID 13333982) has the molecular formula C6HIN4O8 and a molecular weight of 384.00 g/mol. Its IUPAC name is 2-iodo-1,3,4,5-tetranitrobenzene.
| Compound Name | 2-iodo-1,3,4,5-tetranitrobenzene |
|---|---|
| PubChem CID | 13333982 |
| Molecular Formula | C6HIN4O8 |
| Molecular Weight | 384.00 g/mol |
| Exact Mass | 383.88 |
| IUPAC Name | 2-iodo-1,3,4,5-tetranitrobenzene |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1I |
| InChI | InChI=1S/C6HIN4O8/c7-4-2(8(12)13)1-3(9(14)15)5(10(16)17)6(4)11(18)19/h1H |
| InChIKey | IPMCWKMYRKUKCN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.00 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|