C6H6N4O4 — CID 22168448
4,5-dinitrobenzene-1,3-diamine (PubChem CID 22168448) has the molecular formula C6H6N4O4 and a molecular weight of 198.14 g/mol. Its IUPAC name is 4,5-dinitrobenzene-1,3-diamine.
| Compound Name | 4,5-dinitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 22168448 |
| Molecular Formula | C6H6N4O4 |
| Molecular Weight | 198.14 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 4,5-dinitrobenzene-1,3-diamine |
| SMILES | Nc1cc(N)c([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H6N4O4/c7-3-1-4(8)6(10(13)14)5(2-3)9(11)12/h1-2H,7-8H2 |
| InChIKey | AERMZKIAUJDORL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|