C7H6N4O5 — CID 131501988
3-amino-4,5-dinitrobenzamide (PubChem CID 131501988) has the molecular formula C7H6N4O5 and a molecular weight of 226.15 g/mol. Its IUPAC name is 3-amino-4,5-dinitrobenzamide.
| Compound Name | 3-amino-4,5-dinitrobenzamide |
|---|---|
| PubChem CID | 131501988 |
| Molecular Formula | C7H6N4O5 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 3-amino-4,5-dinitrobenzamide |
| SMILES | NC(=O)c1cc(N)c([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H6N4O5/c8-4-1-3(7(9)12)2-5(10(13)14)6(4)11(15)16/h1-2H,8H2,(H2,9,12) |
| InChIKey | VNUARPPPYRGDDV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|