About 3-fluoro-4-nitrobenzamide;urea
3-fluoro-4-nitrobenzamide;urea (PubChem CID 162262537) has the molecular formula C8H9FN4O4
and a molecular weight of 244.18 g/mol. Its IUPAC name is 3-fluoro-4-nitrobenzamide;urea.
Molecular Properties
| Compound Name | 3-fluoro-4-nitrobenzamide;urea |
| PubChem CID | 162262537 |
| Molecular Formula | C8H9FN4O4 |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 3-fluoro-4-nitrobenzamide;urea |
| SMILES | NC(=O)c1ccc([N+](=O)[O-])c(F)c1.NC(N)=O |
| InChI | InChI=1S/C7H5FN2O3.CH4N2O/c8-5-3-4(7(9)11)1-2-6(5)10(12)13;2-1(3)4/h1-3H,(H2,9,11);(H4,2,3,4) |
| InChIKey | ZZLGWASSOUCWRN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 155.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-nitrobenzamide;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-nitrobenzamide;urea?
The IUPAC name of 3-fluoro-4-nitrobenzamide;urea (CID 162262537) is 3-fluoro-4-nitrobenzamide;urea.
What is the SMILES notation for 3-fluoro-4-nitrobenzamide;urea?
The canonical SMILES for 3-fluoro-4-nitrobenzamide;urea is NC(=O)c1ccc([N+](=O)[O-])c(F)c1.NC(N)=O.
What is the InChIKey of 3-fluoro-4-nitrobenzamide;urea?
The InChIKey is ZZLGWASSOUCWRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN2O3.CH4N2O/c8-5-3-4(7(9)11)1-2-6(5)10(12)13;2-1(3)4/h1-3H,(H2,9,11);(H4,2,3,4).
What are the key properties of 3-fluoro-4-nitrobenzamide;urea?
3-fluoro-4-nitrobenzamide;urea has a molecular weight of 244.18 g/mol, XLogP of -0.14, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-nitrobenzamide;urea is sourced from PubChem (CID 162262537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).