About pentyl 3-fluoro-4-nitrobenzoate
pentyl 3-fluoro-4-nitrobenzoate (PubChem CID 63841506) has the molecular formula C12H14FNO4
and a molecular weight of 255.24 g/mol. Its IUPAC name is pentyl 3-fluoro-4-nitrobenzoate.
Molecular Properties
| Compound Name | pentyl 3-fluoro-4-nitrobenzoate |
| PubChem CID | 63841506 |
| Molecular Formula | C12H14FNO4 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | pentyl 3-fluoro-4-nitrobenzoate |
| SMILES | CCCCCOC(=O)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C12H14FNO4/c1-2-3-4-7-18-12(15)9-5-6-11(14(16)17)10(13)8-9/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | HDQZXJMSGKUIAR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pentyl 3-fluoro-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 3-fluoro-4-nitrobenzoate?
The IUPAC name of pentyl 3-fluoro-4-nitrobenzoate (CID 63841506) is pentyl 3-fluoro-4-nitrobenzoate.
What is the SMILES notation for pentyl 3-fluoro-4-nitrobenzoate?
The canonical SMILES for pentyl 3-fluoro-4-nitrobenzoate is CCCCCOC(=O)c1ccc([N+](=O)[O-])c(F)c1.
What is the InChIKey of pentyl 3-fluoro-4-nitrobenzoate?
The InChIKey is HDQZXJMSGKUIAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO4/c1-2-3-4-7-18-12(15)9-5-6-11(14(16)17)10(13)8-9/h5-6,8H,2-4,7H2,1H3.
What are the key properties of pentyl 3-fluoro-4-nitrobenzoate?
pentyl 3-fluoro-4-nitrobenzoate has a molecular weight of 255.24 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 3-fluoro-4-nitrobenzoate is sourced from PubChem (CID 63841506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).