About 3-phenoxypropyl 3-fluoro-4-nitrobenzoate
3-phenoxypropyl 3-fluoro-4-nitrobenzoate (PubChem CID 56506305) has the molecular formula C16H14FNO5
and a molecular weight of 319.29 g/mol. Its IUPAC name is 3-phenoxypropyl 3-fluoro-4-nitrobenzoate.
Molecular Properties
| Compound Name | 3-phenoxypropyl 3-fluoro-4-nitrobenzoate |
| PubChem CID | 56506305 |
| Molecular Formula | C16H14FNO5 |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-phenoxypropyl 3-fluoro-4-nitrobenzoate |
| SMILES | O=C(OCCCOc1ccccc1)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C16H14FNO5/c17-14-11-12(7-8-15(14)18(20)21)16(19)23-10-4-9-22-13-5-2-1-3-6-13/h1-3,5-8,11H,4,9-10H2 |
| InChIKey | FRZSMCXKMRQSGB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-phenoxypropyl 3-fluoro-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenoxypropyl 3-fluoro-4-nitrobenzoate?
The IUPAC name of 3-phenoxypropyl 3-fluoro-4-nitrobenzoate (CID 56506305) is 3-phenoxypropyl 3-fluoro-4-nitrobenzoate.
What is the SMILES notation for 3-phenoxypropyl 3-fluoro-4-nitrobenzoate?
The canonical SMILES for 3-phenoxypropyl 3-fluoro-4-nitrobenzoate is O=C(OCCCOc1ccccc1)c1ccc([N+](=O)[O-])c(F)c1.
What is the InChIKey of 3-phenoxypropyl 3-fluoro-4-nitrobenzoate?
The InChIKey is FRZSMCXKMRQSGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO5/c17-14-11-12(7-8-15(14)18(20)21)16(19)23-10-4-9-22-13-5-2-1-3-6-13/h1-3,5-8,11H,4,9-10H2.
What are the key properties of 3-phenoxypropyl 3-fluoro-4-nitrobenzoate?
3-phenoxypropyl 3-fluoro-4-nitrobenzoate has a molecular weight of 319.29 g/mol, XLogP of 3.36, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenoxypropyl 3-fluoro-4-nitrobenzoate is sourced from PubChem (CID 56506305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).