About [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate
[3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate (PubChem CID 56506307) has the molecular formula C16H13FN2O6
and a molecular weight of 348.29 g/mol. Its IUPAC name is [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate.
Molecular Properties
| Compound Name | [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate |
| PubChem CID | 56506307 |
| Molecular Formula | C16H13FN2O6 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate |
| SMILES | NC(=O)COc1cccc(COC(=O)c2ccc([N+](=O)[O-])c(F)c2)c1 |
| InChI | InChI=1S/C16H13FN2O6/c17-13-7-11(4-5-14(13)19(22)23)16(21)25-8-10-2-1-3-12(6-10)24-9-15(18)20/h1-7H,8-9H2,(H2,18,20) |
| InChIKey | NXHSNASHEOKFPI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate?
The IUPAC name of [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate (CID 56506307) is [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate.
What is the SMILES notation for [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate?
The canonical SMILES for [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate is NC(=O)COc1cccc(COC(=O)c2ccc([N+](=O)[O-])c(F)c2)c1.
What is the InChIKey of [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate?
The InChIKey is NXHSNASHEOKFPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O6/c17-13-7-11(4-5-14(13)19(22)23)16(21)25-8-10-2-1-3-12(6-10)24-9-15(18)20/h1-7H,8-9H2,(H2,18,20).
What are the key properties of [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate?
[3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate has a molecular weight of 348.29 g/mol, XLogP of 1.96, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-amino-2-oxoethoxy)phenyl]methyl 3-fluoro-4-nitrobenzoate is sourced from PubChem (CID 56506307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).