C13H10N4O4 — CID 87178850
4,5-dinitro-9H-fluorene-2,7-diamine (PubChem CID 87178850) has the molecular formula C13H10N4O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is 4,5-dinitro-9H-fluorene-2,7-diamine.
| Compound Name | 4,5-dinitro-9H-fluorene-2,7-diamine |
|---|---|
| PubChem CID | 87178850 |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 4,5-dinitro-9H-fluorene-2,7-diamine |
| SMILES | Nc1cc2c(c([N+](=O)[O-])c1)-c1c(cc(N)cc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C13H10N4O4/c14-8-2-6-1-7-3-9(15)5-11(17(20)21)13(7)12(6)10(4-8)16(18)19/h2-5H,1,14-15H2 |
| InChIKey | OFEGSKHQVGFDCI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|