C6H4N4O7 — CID 174982117
5-amino-2,3,4-trinitrophenol (PubChem CID 174982117) has the molecular formula C6H4N4O7 and a molecular weight of 244.12 g/mol. Its IUPAC name is 5-amino-2,3,4-trinitrophenol.
| Compound Name | 5-amino-2,3,4-trinitrophenol |
|---|---|
| PubChem CID | 174982117 |
| Molecular Formula | C6H4N4O7 |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 5-amino-2,3,4-trinitrophenol |
| SMILES | Nc1cc(O)c([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4N4O7/c7-2-1-3(11)5(9(14)15)6(10(16)17)4(2)8(12)13/h1,11H,7H2 |
| InChIKey | CSWNJQGNTVXTGG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 175.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|