C6H4N2O6 — CID 89183388
2,5-dinitrobenzene-1,3-diol (PubChem CID 89183388) has the molecular formula C6H4N2O6 and a molecular weight of 200.11 g/mol. Its IUPAC name is 2,5-dinitrobenzene-1,3-diol.
| Compound Name | 2,5-dinitrobenzene-1,3-diol |
|---|---|
| PubChem CID | 89183388 |
| Molecular Formula | C6H4N2O6 |
| Molecular Weight | 200.11 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | 2,5-dinitrobenzene-1,3-diol |
| SMILES | O=[N+]([O-])c1cc(O)c([N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C6H4N2O6/c9-4-1-3(7(11)12)2-5(10)6(4)8(13)14/h1-2,9-10H |
| InChIKey | QJQWGNIPQSFXQF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.11 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|