C9H10N4O5 — CID 123844151
1-(2,3-diamino-5,6-dinitrophenyl)propan-1-one (PubChem CID 123844151) has the molecular formula C9H10N4O5 and a molecular weight of 254.20 g/mol. Its IUPAC name is 1-(2,3-diamino-5,6-dinitrophenyl)propan-1-one.
| Compound Name | 1-(2,3-diamino-5,6-dinitrophenyl)propan-1-one |
|---|---|
| PubChem CID | 123844151 |
| Molecular Formula | C9H10N4O5 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-(2,3-diamino-5,6-dinitrophenyl)propan-1-one |
| SMILES | CCC(=O)c1c(N)c(N)cc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N4O5/c1-2-6(14)7-8(11)4(10)3-5(12(15)16)9(7)13(17)18/h3H,2,10-11H2,1H3 |
| InChIKey | OJTUKZVCDLXXAG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|