C9H7ClN2O5 — CID 174987779
1-(3-chloro-2,4-dinitrophenyl)propan-1-one (PubChem CID 174987779) has the molecular formula C9H7ClN2O5 and a molecular weight of 258.62 g/mol. Its IUPAC name is 1-(3-chloro-2,4-dinitrophenyl)propan-1-one.
| Compound Name | 1-(3-chloro-2,4-dinitrophenyl)propan-1-one |
|---|---|
| PubChem CID | 174987779 |
| Molecular Formula | C9H7ClN2O5 |
| Molecular Weight | 258.62 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 1-(3-chloro-2,4-dinitrophenyl)propan-1-one |
| SMILES | CCC(=O)c1ccc([N+](=O)[O-])c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7ClN2O5/c1-2-7(13)5-3-4-6(11(14)15)8(10)9(5)12(16)17/h3-4H,2H2,1H3 |
| InChIKey | OZFLQRGABMHSJV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.62 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|