C10H9Cl2NO3 — CID 162147986
1-(2,6-dichloro-3-nitrophenyl)butan-1-one (PubChem CID 162147986) has the molecular formula C10H9Cl2NO3 and a molecular weight of 262.09 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-nitrophenyl)butan-1-one.
| Compound Name | 1-(2,6-dichloro-3-nitrophenyl)butan-1-one |
|---|---|
| PubChem CID | 162147986 |
| Molecular Formula | C10H9Cl2NO3 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 1-(2,6-dichloro-3-nitrophenyl)butan-1-one |
| SMILES | CCCC(=O)c1c(Cl)ccc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C10H9Cl2NO3/c1-2-3-8(14)9-6(11)4-5-7(10(9)12)13(15)16/h4-5H,2-3H2,1H3 |
| InChIKey | QQPAZSQZPXWZJY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|