C14H11Cl2N3O3 — CID 140860131
N-(4-aminophenyl)-2,6-dichloro-N-methyl-3-nitrobenzamide (PubChem CID 140860131) has the molecular formula C14H11Cl2N3O3 and a molecular weight of 340.17 g/mol. Its IUPAC name is N-(4-aminophenyl)-2,6-dichloro-N-methyl-3-nitrobenzamide.
| Compound Name | N-(4-aminophenyl)-2,6-dichloro-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 140860131 |
| Molecular Formula | C14H11Cl2N3O3 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | N-(4-aminophenyl)-2,6-dichloro-N-methyl-3-nitrobenzamide |
| SMILES | CN(C(=O)c1c(Cl)ccc([N+](=O)[O-])c1Cl)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H11Cl2N3O3/c1-18(9-4-2-8(17)3-5-9)14(20)12-10(15)6-7-11(13(12)16)19(21)22/h2-7H,17H2,1H3 |
| InChIKey | JEGHYDIJYCMIQE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|