About nitro(1H-1,2,4-triazol-5-yl)azanide
nitro(1H-1,2,4-triazol-5-yl)azanide (PubChem CID 139094407) has the molecular formula C2H2N5O2-
and a molecular weight of 128.07 g/mol. Its IUPAC name is nitro(1H-1,2,4-triazol-5-yl)azanide.
Molecular Properties
| Compound Name | nitro(1H-1,2,4-triazol-5-yl)azanide |
| PubChem CID | 139094407 |
| Molecular Formula | C2H2N5O2- |
| Molecular Weight | 128.07 g/mol |
| Exact Mass | 128.02 |
| IUPAC Name | nitro(1H-1,2,4-triazol-5-yl)azanide |
| SMILES | O=[N+]([O-])[N-]c1ncn[nH]1 |
| InChI | InChI=1S/C2H2N5O2/c8-7(9)6-2-3-1-4-5-2/h1H,(H-,3,4,5,6)/q-1 |
| InChIKey | DHGIZJZJGIWERS-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 98.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.07 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitro(1H-1,2,4-triazol-5-yl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitro(1H-1,2,4-triazol-5-yl)azanide?
The IUPAC name of nitro(1H-1,2,4-triazol-5-yl)azanide (CID 139094407) is nitro(1H-1,2,4-triazol-5-yl)azanide.
What is the SMILES notation for nitro(1H-1,2,4-triazol-5-yl)azanide?
The canonical SMILES for nitro(1H-1,2,4-triazol-5-yl)azanide is O=[N+]([O-])[N-]c1ncn[nH]1.
What is the InChIKey of nitro(1H-1,2,4-triazol-5-yl)azanide?
The InChIKey is DHGIZJZJGIWERS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2N5O2/c8-7(9)6-2-3-1-4-5-2/h1H,(H-,3,4,5,6)/q-1.
What are the key properties of nitro(1H-1,2,4-triazol-5-yl)azanide?
nitro(1H-1,2,4-triazol-5-yl)azanide has a molecular weight of 128.07 g/mol, XLogP of 0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitro(1H-1,2,4-triazol-5-yl)azanide is sourced from PubChem (CID 139094407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).