C2H2N5O2- — CID 139094407
nitro(1H-1,2,4-triazol-5-yl)azanide (PubChem CID 139094407) has the molecular formula C2H2N5O2- and a molecular weight of 128.07 g/mol. Its IUPAC name is nitro(1H-1,2,4-triazol-5-yl)azanide.
| Compound Name | nitro(1H-1,2,4-triazol-5-yl)azanide |
|---|---|
| PubChem CID | 139094407 |
| Molecular Formula | C2H2N5O2- |
| Molecular Weight | 128.07 g/mol |
| Exact Mass | 128.02 |
| IUPAC Name | nitro(1H-1,2,4-triazol-5-yl)azanide |
| SMILES | O=[N+]([O-])[N-]c1ncn[nH]1 |
| InChI | InChI=1S/C2H2N5O2/c8-7(9)6-2-3-1-4-5-2/h1H,(H-,3,4,5,6)/q-1 |
| InChIKey | DHGIZJZJGIWERS-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 98.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.07 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|