C8H8N6O3 — CID 54883391
5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrrole-2-carboxamide (PubChem CID 54883391) has the molecular formula C8H8N6O3 and a molecular weight of 236.19 g/mol. Its IUPAC name is 5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 54883391 |
| Molecular Formula | C8H8N6O3 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCc1ncn[nH]1)c1ccc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C8H8N6O3/c15-8(9-3-6-10-4-11-13-6)5-1-2-7(12-5)14(16)17/h1-2,4,12H,3H2,(H,9,15)(H,10,11,13) |
| InChIKey | ZINIMDYRBGXMEF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|