C10H10N6O3 — CID 115549169
3-amino-2-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 115549169) has the molecular formula C10H10N6O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is 3-amino-2-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | 3-amino-2-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 115549169 |
| Molecular Formula | C10H10N6O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-amino-2-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | Nc1cccc(C(=O)NCc2ncn[nH]2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N6O3/c11-7-3-1-2-6(9(7)16(18)19)10(17)12-4-8-13-5-14-15-8/h1-3,5H,4,11H2,(H,12,17)(H,13,14,15) |
| InChIKey | FSFYFNVLKKCMND-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|