C11H11N5O3 — CID 54883775
2-methyl-6-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 54883775) has the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-methyl-6-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | 2-methyl-6-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54883775 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-methyl-6-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1C(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C11H11N5O3/c1-7-3-2-4-8(16(18)19)10(7)11(17)12-5-9-13-6-14-15-9/h2-4,6H,5H2,1H3,(H,12,17)(H,13,14,15) |
| InChIKey | CGXRJSQKLYCHIQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|