C10H11N7O3 — CID 64525183
5-hydrazinyl-2-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 64525183) has the molecular formula C10H11N7O3 and a molecular weight of 277.24 g/mol. Its IUPAC name is 5-hydrazinyl-2-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | 5-hydrazinyl-2-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 64525183 |
| Molecular Formula | C10H11N7O3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 5-hydrazinyl-2-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | NNc1ccc([N+](=O)[O-])c(C(=O)NCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C10H11N7O3/c11-15-6-1-2-8(17(19)20)7(3-6)10(18)12-4-9-13-5-14-16-9/h1-3,5,15H,4,11H2,(H,12,18)(H,13,14,16) |
| InChIKey | QJMZPRWTDQJCJL-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 151.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|