C10H8BrClN4O — CID 86785577
3-bromo-2-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 86785577) has the molecular formula C10H8BrClN4O and a molecular weight of 315.56 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | 3-bromo-2-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 86785577 |
| Molecular Formula | C10H8BrClN4O |
| Molecular Weight | 315.56 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | 3-bromo-2-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1ncn[nH]1)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C10H8BrClN4O/c11-7-3-1-2-6(9(7)12)10(17)13-4-8-14-5-15-16-8/h1-3,5H,4H2,(H,13,17)(H,14,15,16) |
| InChIKey | FXOSGOXRBGSMOK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |