C6H3ClN6O2S — CID 62102349
4-chloro-5-nitro-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidine (PubChem CID 62102349) has the molecular formula C6H3ClN6O2S and a molecular weight of 258.65 g/mol. Its IUPAC name is 4-chloro-5-nitro-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidine.
| Compound Name | 4-chloro-5-nitro-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidine |
|---|---|
| PubChem CID | 62102349 |
| Molecular Formula | C6H3ClN6O2S |
| Molecular Weight | 258.65 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 4-chloro-5-nitro-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidine |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1Sc1ncn[nH]1 |
| InChI | InChI=1S/C6H3ClN6O2S/c7-4-3(13(14)15)5(9-1-8-4)16-6-10-2-11-12-6/h1-2H,(H,10,11,12) |
| InChIKey | JCXIQKVMVSYGBF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.65 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|