methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate

C7H6ClN3O4S — CID 62102190

IUPACmethyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate
SMILESCOC(=O)CSc1ncnc(Cl)c1[N+](=O)[O-]
InChIInChI=1S/C7H6ClN3O4S/c1-15-4(12)2-16-7-5(11(13)14)6(8)9-3-10-7/h3H,2H2,1H3
InChIKeyABKSDQZDVHOHHZ-UHFFFAOYSA-N
MW263.66 g/mol
LogP1.30
Rot. Bonds4

About methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate

methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate (PubChem CID 62102190) has the molecular formula C7H6ClN3O4S and a molecular weight of 263.66 g/mol. Its IUPAC name is methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate.

Molecular Properties

Compound Namemethyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate
PubChem CID62102190
Molecular FormulaC7H6ClN3O4S
Molecular Weight263.66 g/mol
Exact Mass262.98
IUPAC Namemethyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate
SMILESCOC(=O)CSc1ncnc(Cl)c1[N+](=O)[O-]
InChIInChI=1S/C7H6ClN3O4S/c1-15-4(12)2-16-7-5(11(13)14)6(8)9-3-10-7/h3H,2H2,1H3
InChIKeyABKSDQZDVHOHHZ-UHFFFAOYSA-N
XLogP1.30
TPSA95.22 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.66
LogP ≤ 51.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate?
The IUPAC name of methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate (CID 62102190) is methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate.
What is the SMILES notation for methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate?
The canonical SMILES for methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate is COC(=O)CSc1ncnc(Cl)c1[N+](=O)[O-].
What is the InChIKey of methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate?
The InChIKey is ABKSDQZDVHOHHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3O4S/c1-15-4(12)2-16-7-5(11(13)14)6(8)9-3-10-7/h3H,2H2,1H3.
What are the key properties of methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate?
methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate has a molecular weight of 263.66 g/mol, XLogP of 1.30, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanylacetate is sourced from PubChem (CID 62102190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).