C10H8ClN5O2S — CID 62305489
2-(6-chloro-5-nitropyrimidin-4-yl)sulfanyl-4,6-dimethylpyrimidine (PubChem CID 62305489) has the molecular formula C10H8ClN5O2S and a molecular weight of 297.73 g/mol. Its IUPAC name is 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanyl-4,6-dimethylpyrimidine.
| Compound Name | 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanyl-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 62305489 |
| Molecular Formula | C10H8ClN5O2S |
| Molecular Weight | 297.73 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 2-(6-chloro-5-nitropyrimidin-4-yl)sulfanyl-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(Sc2ncnc(Cl)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H8ClN5O2S/c1-5-3-6(2)15-10(14-5)19-9-7(16(17)18)8(11)12-4-13-9/h3-4H,1-2H3 |
| InChIKey | QDYYPMSVRAQLLU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 94.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.73 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|