C9H11ClN4O4 — CID 114284007
methyl 3-[(6-chloro-5-nitropyrimidin-4-yl)amino]butanoate (PubChem CID 114284007) has the molecular formula C9H11ClN4O4 and a molecular weight of 274.66 g/mol. Its IUPAC name is methyl 3-[(6-chloro-5-nitropyrimidin-4-yl)amino]butanoate.
| Compound Name | methyl 3-[(6-chloro-5-nitropyrimidin-4-yl)amino]butanoate |
|---|---|
| PubChem CID | 114284007 |
| Molecular Formula | C9H11ClN4O4 |
| Molecular Weight | 274.66 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | methyl 3-[(6-chloro-5-nitropyrimidin-4-yl)amino]butanoate |
| SMILES | COC(=O)CC(C)Nc1ncnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11ClN4O4/c1-5(3-6(15)18-2)13-9-7(14(16)17)8(10)11-4-12-9/h4-5H,3H2,1-2H3,(H,11,12,13) |
| InChIKey | SEBGGOZDKPIALA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.66 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|