C9H6N4O4S — CID 82784315
4-nitro-3-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid (PubChem CID 82784315) has the molecular formula C9H6N4O4S and a molecular weight of 266.24 g/mol. Its IUPAC name is 4-nitro-3-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid.
| Compound Name | 4-nitro-3-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 82784315 |
| Molecular Formula | C9H6N4O4S |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 4-nitro-3-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(Sc2ncn[nH]2)c1 |
| InChI | InChI=1S/C9H6N4O4S/c14-8(15)5-1-2-6(13(16)17)7(3-5)18-9-10-4-11-12-9/h1-4H,(H,14,15)(H,10,11,12) |
| InChIKey | HRHWRTSOMMSZCO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|