C10H10N8O2S — CID 98005258
2-[(E)-[3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methylideneamino]guanidine (PubChem CID 98005258) has the molecular formula C10H10N8O2S and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-[(E)-[3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 98005258 |
| Molecular Formula | C10H10N8O2S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-[(E)-[3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1ccc(Sc2ncn[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10N8O2S/c11-9(12)16-14-4-6-1-2-8(7(3-6)18(19)20)21-10-13-5-15-17-10/h1-5H,(H4,11,12,16)(H,13,15,17)/b14-4+ |
| InChIKey | QHNFMZXYRKDWHQ-LNKIKWGQSA-N |
| XLogP | 0.47 |
| TPSA | 161.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|