C9H6F3N5O2S — CID 3806117
3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-amine (PubChem CID 3806117) has the molecular formula C9H6F3N5O2S and a molecular weight of 305.24 g/mol. Its IUPAC name is 3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 3806117 |
| Molecular Formula | C9H6F3N5O2S |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(Sc2ccc(C(F)(F)F)cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C9H6F3N5O2S/c10-9(11,12)4-1-2-6(5(3-4)17(18)19)20-8-14-7(13)15-16-8/h1-3H,(H3,13,14,15,16) |
| InChIKey | MWGDRMANQAPVLT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|