C9H5F3N6O4S — CID 5102388
3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-amine (PubChem CID 5102388) has the molecular formula C9H5F3N6O4S and a molecular weight of 350.24 g/mol. Its IUPAC name is 3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 5102388 |
| Molecular Formula | C9H5F3N6O4S |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(Sc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C9H5F3N6O4S/c10-9(11,12)3-1-4(17(19)20)6(5(2-3)18(21)22)23-8-14-7(13)15-16-8/h1-2H,(H3,13,14,15,16) |
| InChIKey | JFLOLSPEDIXOBO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 153.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|