C12H12F3N6O2S+ — CID 6852781
dimethyl-[[[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-yl]amino]methylidene]azanium (PubChem CID 6852781) has the molecular formula C12H12F3N6O2S+ and a molecular weight of 361.33 g/mol. Its IUPAC name is dimethyl-[[[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-yl]amino]methylidene]azanium.
| Compound Name | dimethyl-[[[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-yl]amino]methylidene]azanium |
|---|---|
| PubChem CID | 6852781 |
| Molecular Formula | C12H12F3N6O2S+ |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | dimethyl-[[[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-yl]amino]methylidene]azanium |
| SMILES | C[N+](C)=CNc1nc(Sc2ccc(C(F)(F)F)cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C12H11F3N6O2S/c1-20(2)6-16-10-17-11(19-18-10)24-9-4-3-7(12(13,14)15)5-8(9)21(22)23/h3-6H,1-2H3,(H,17,18,19)/p+1 |
| InChIKey | JFDYZSOIOOLMNI-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|