C17H15N7O3S2 — CID 4567512
1-benzyl-3-[[3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoyl]amino]thiourea (PubChem CID 4567512) has the molecular formula C17H15N7O3S2 and a molecular weight of 429.49 g/mol. Its IUPAC name is 1-benzyl-3-[[3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoyl]amino]thiourea.
| Compound Name | 1-benzyl-3-[[3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 4567512 |
| Molecular Formula | C17H15N7O3S2 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 1-benzyl-3-[[3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoyl]amino]thiourea |
| SMILES | O=C(NNC(=S)NCc1ccccc1)c1ccc(Sc2ncn[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15N7O3S2/c25-15(21-22-16(28)18-9-11-4-2-1-3-5-11)12-6-7-14(13(8-12)24(26)27)29-17-19-10-20-23-17/h1-8,10H,9H2,(H,21,25)(H2,18,22,28)(H,19,20,23) |
| InChIKey | HFCOBNFSAYMFGK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|