C22H16N6O7S2 — CID 6093044
N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide (PubChem CID 6093044) has the molecular formula C22H16N6O7S2 and a molecular weight of 540.54 g/mol. Its IUPAC name is N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide.
| Compound Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 6093044 |
| Molecular Formula | C22H16N6O7S2 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc3c(c2)OCO3)C1=O)c1ccc(Sc2ncn[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H16N6O7S2/c29-19(13-2-4-17(14(9-13)28(32)33)36-21-24-10-25-26-21)23-5-6-27-20(30)18(37-22(27)31)8-12-1-3-15-16(7-12)35-11-34-15/h1-4,7-10H,5-6,11H2,(H,23,29)(H,24,25,26)/b18-8- |
| InChIKey | LWJCGMFOWQZHCU-LSCVHKIXSA-N |
| XLogP | 3.06 |
| TPSA | 169.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|