C19H13N5O4S — CID 71699045
N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-nitrobenzamide (PubChem CID 71699045) has the molecular formula C19H13N5O4S and a molecular weight of 407.41 g/mol. Its IUPAC name is N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-nitrobenzamide.
| Compound Name | N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 71699045 |
| Molecular Formula | C19H13N5O4S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-nitrobenzamide |
| SMILES | O=C(Nc1cc(Sc2ncn[nH]2)c(O)c2ccccc12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H13N5O4S/c25-17-14-4-2-1-3-13(14)15(9-16(17)29-19-20-10-21-23-19)22-18(26)11-5-7-12(8-6-11)24(27)28/h1-10,25H,(H,22,26)(H,20,21,23) |
| InChIKey | FZTZLRGWBRXYIJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|